Benzenebutanoicacid, g-[2-(aminocarbonyl)hydrazinylidene]-,ethyl ester structure
|
Common Name | Benzenebutanoicacid, g-[2-(aminocarbonyl)hydrazinylidene]-,ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 7497-67-8 | Molecular Weight | 263.29200 | |
| Density | 1.19g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C13H17N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 4-(carbamoylhydrazinylidene)-4-phenylbutanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.19g/cm3 |
|---|---|
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.29200 |
| Exact Mass | 263.12700 |
| PSA | 93.78000 |
| LogP | 2.49350 |
| Index of Refraction | 1.558 |
| InChIKey | IVEPTQXZYBJWCG-PTNGSMBKSA-N |
| SMILES | CCOC(=O)CCC(=NNC(N)=O)c1ccccc1 |
|
~%
Benzenebutanoic... CAS#:7497-67-8 |
| Literature: Mortenson; Spielman Journal of the American Chemical Society, 1940 , vol. 62, p. 1609 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 4-Phenyl-4-semicarbazono-buttersaeure-aethylester |
| 4-phenyl-4-semicarbazono-butyric acid ethyl ester |