Propanedioic acid,1,3-bis(2-[1,1'-biphenyl]-4-yl-2-oxoethyl) ester structure
|
Common Name | Propanedioic acid,1,3-bis(2-[1,1'-biphenyl]-4-yl-2-oxoethyl) ester | ||
|---|---|---|---|---|
| CAS Number | 7497-83-8 | Molecular Weight | 492.51900 | |
| Density | 1.229g/cm3 | Boiling Point | 666.4ºC at 760 mmHg | |
| Molecular Formula | C31H24O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 282.4ºC | |
| Name | bis[2-oxo-2-(4-phenylphenyl)ethyl] propanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.229g/cm3 |
|---|---|
| Boiling Point | 666.4ºC at 760 mmHg |
| Molecular Formula | C31H24O6 |
| Molecular Weight | 492.51900 |
| Flash Point | 282.4ºC |
| Exact Mass | 492.15700 |
| PSA | 86.74000 |
| LogP | 5.56270 |
| Index of Refraction | 1.6 |
| InChIKey | QXVJDUZMZRPYRA-UHFFFAOYSA-N |
| SMILES | O=C(CC(=O)OCC(=O)c1ccc(-c2ccccc2)cc1)OCC(=O)c1ccc(-c2ccccc2)cc1 |
|
~%
Propanedioic ac... CAS#:7497-83-8 |
| Literature: Drake; Sweeney Journal of the American Chemical Society, 1932 , vol. 54, p. 2059 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| p-Phenylphenacylmalonat |