N,N-diethyl-2-(2,3,4,5,6-pentachlorophenoxy)ethanamine structure
|
Common Name | N,N-diethyl-2-(2,3,4,5,6-pentachlorophenoxy)ethanamine | ||
|---|---|---|---|---|
| CAS Number | 7497-94-1 | Molecular Weight | 365.51100 | |
| Density | 1.389g/cm3 | Boiling Point | 409.6ºC at 760 mmHg | |
| Molecular Formula | C12H14Cl5NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 201.5ºC | |
| Name | N,N-diethyl-2-(2,3,4,5,6-pentachlorophenoxy)ethanamine |
|---|
| Density | 1.389g/cm3 |
|---|---|
| Boiling Point | 409.6ºC at 760 mmHg |
| Molecular Formula | C12H14Cl5NO |
| Molecular Weight | 365.51100 |
| Flash Point | 201.5ºC |
| Exact Mass | 362.95200 |
| PSA | 12.47000 |
| LogP | 5.67420 |
| Index of Refraction | 1.554 |
| InChIKey | RZAGKPGSXHKXRG-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCOc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
|
~%
N,N-diethyl-2-(... CAS#:7497-94-1 |
| Literature: Drain; Peak; Whitmont Journal of the Chemical Society, 1949 , p. 2680,2681 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |