(1-nitrocyclohexyl) thiocyanate structure
|
Common Name | (1-nitrocyclohexyl) thiocyanate | ||
|---|---|---|---|---|
| CAS Number | 74974-48-4 | Molecular Weight | 186.23100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H10N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (1-nitrocyclohexyl) thiocyanate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H10N2O2S |
|---|---|
| Molecular Weight | 186.23100 |
| Exact Mass | 186.04600 |
| PSA | 94.91000 |
| LogP | 2.66098 |
| InChIKey | KOJSICFEMDHPBO-UHFFFAOYSA-N |
| SMILES | N#CSC1([N+](=O)[O-])CCCCC1 |
|
~43%
(1-nitrocyclohe... CAS#:74974-48-4 |
| Literature: Al-Khalil; Bowman; Gaitonde; Marley; Richardson Journal of the Chemical Society, Perkin Transactions 2, 2001 , # 9 p. 1557 - 1565 |
|
~42%
(1-nitrocyclohe... CAS#:74974-48-4 |
| Literature: Al-Khalil, Suleiman I.; Bowman, W. Russell Tetrahedron Letters, 1983 , vol. 24, # 24 p. 2517 - 2520 |
| 1-nitro-1-thiocyanatocyclohexane |
| Thiocyanic acid,1-nitrocyclohexyl ester |