2-(5-methyl-5-phenyl-1-cyclopentenyl)acetic acid structure
|
Common Name | 2-(5-methyl-5-phenyl-1-cyclopentenyl)acetic acid | ||
|---|---|---|---|---|
| CAS Number | 7498-76-2 | Molecular Weight | 216.27600 | |
| Density | 1.11g/cm3 | Boiling Point | 353.6ºC at 760 mmHg | |
| Molecular Formula | C14H16O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 250.5ºC | |
| Name | 2-(5-methyl-5-phenylcyclopenten-1-yl)acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.11g/cm3 |
|---|---|
| Boiling Point | 353.6ºC at 760 mmHg |
| Molecular Formula | C14H16O2 |
| Molecular Weight | 216.27600 |
| Flash Point | 250.5ºC |
| Exact Mass | 216.11500 |
| PSA | 37.30000 |
| LogP | 3.13920 |
| Index of Refraction | 1.555 |
| InChIKey | QAIAMWFHCNTPDG-UHFFFAOYSA-N |
| SMILES | CC1(c2ccccc2)CCC=C1CC(=O)O |
|
~%
2-(5-methyl-5-p... CAS#:7498-76-2 |
| Literature: Newman; Closson Journal of the American Chemical Society, 1944 , vol. 66, p. 1553 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 5-methyl-5-phenyl-1-cyclopentene-1-acetic acid |