N-[4-(1-cyclohexenyl)but-3-yn-2-ylideneamino]-2,4-dinitro-aniline structure
|
Common Name | N-[4-(1-cyclohexenyl)but-3-yn-2-ylideneamino]-2,4-dinitro-aniline | ||
|---|---|---|---|---|
| CAS Number | 7498-91-1 | Molecular Weight | 328.32300 | |
| Density | 1.3g/cm3 | Boiling Point | 484.9ºC at 760 mmHg | |
| Molecular Formula | C16H16N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 247.1ºC | |
| Name | N-[(E)-4-(cyclohexen-1-yl)but-3-yn-2-ylideneamino]-2,4-dinitroaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3g/cm3 |
|---|---|
| Boiling Point | 484.9ºC at 760 mmHg |
| Molecular Formula | C16H16N4O4 |
| Molecular Weight | 328.32300 |
| Flash Point | 247.1ºC |
| Exact Mass | 328.11700 |
| PSA | 116.03000 |
| LogP | 4.91400 |
| Index of Refraction | 1.617 |
| InChIKey | YWUOEQGTJNOVPT-SFQUDFHCSA-N |
| SMILES | CC(C#CC1=CCCCC1)=NNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
|
~%
N-[4-(1-cyclohe... CAS#:7498-91-1 |
| Literature: Sobotka; Chanley Journal of the American Chemical Society, 1948 , vol. 70, p. 3914,3917 Show Details Heilbron; Jones; Richardson Journal of the Chemical Society, 1949 , p. 287,292 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 4-Cyclohex-1-enyl-benzoesaeure |
| 4-cyclohex-1-enyl-benzoic acid |