2,5-Cyclohexadien-1-one,3,4-dimethyl-4-(trichloromethyl)- structure
|
Common Name | 2,5-Cyclohexadien-1-one,3,4-dimethyl-4-(trichloromethyl)- | ||
|---|---|---|---|---|
| CAS Number | 7499-12-9 | Molecular Weight | 239.52600 | |
| Density | 1.354g/cm3 | Boiling Point | 300.4ºC at 760mmHg | |
| Molecular Formula | C9H9Cl3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 125.8ºC | |
| Name | 3,4-dimethyl-4-(trichloromethyl)cyclohexa-2,5-dien-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.354g/cm3 |
|---|---|
| Boiling Point | 300.4ºC at 760mmHg |
| Molecular Formula | C9H9Cl3O |
| Molecular Weight | 239.52600 |
| Flash Point | 125.8ºC |
| Exact Mass | 237.97200 |
| PSA | 17.07000 |
| LogP | 3.44810 |
| Index of Refraction | 1.536 |
| InChIKey | HDMAZHTXTAAUMK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)C=CC1(C)C(Cl)(Cl)Cl |
|
~%
2,5-Cyclohexadi... CAS#:7499-12-9 |
| Literature: Newman et al. Journal of the American Chemical Society, 1959 , vol. 81, p. 6454 |
| Precursor 2 | |
|---|---|
| DownStream 10 | |
| 3,4-Dimethyl-4-trichlormethyl-cyclohexadien-(2,5)-on-(1) |
| 3,4-dimethyl-4-(trichloromethyl)-2,5-cyclohexadienone |
| 3,4-dimethyl-4-trichloromethyl-2,5-cyclohexadien-1-one |
| 3,4-Dimethyl-4-trichlormethyl-cyclohexa-2,5-dienon |
| 3,4-dimethyl-4-trichloromethyl-cyclohexa-2,5-dienone |