Butanoic acid,2-(aminocarbonyl)-3-methyl-2-(1-methylethyl)- structure
|
Common Name | Butanoic acid,2-(aminocarbonyl)-3-methyl-2-(1-methylethyl)- | ||
|---|---|---|---|---|
| CAS Number | 7499-15-2 | Molecular Weight | 187.23600 | |
| Density | 1.08g/cm3 | Boiling Point | 352.7ºC at 760 mmHg | |
| Molecular Formula | C9H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 167.1ºC | |
| Name | 2-carbamoyl-3-methyl-2-propan-2-ylbutanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.08g/cm3 |
|---|---|
| Boiling Point | 352.7ºC at 760 mmHg |
| Molecular Formula | C9H17NO3 |
| Molecular Weight | 187.23600 |
| Flash Point | 167.1ºC |
| Exact Mass | 187.12100 |
| PSA | 80.39000 |
| LogP | 1.55500 |
| Index of Refraction | 1.474 |
| InChIKey | BQOUKOFSUDJODA-UHFFFAOYSA-N |
| SMILES | CC(C)C(C(N)=O)(C(=O)O)C(C)C |
| HS Code | 2924199090 |
|---|
|
~%
Butanoic acid,2... CAS#:7499-15-2 |
| Literature: Marshall Journal of the Chemical Society, 1930 , p. 2760 Journal of the Chemical Society, 1931 , p. 2338 |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2,2-diisopropyl-malonamic acid |
| Diisopropyl-malonsaeureamid |
| 2,2,-Diisopropyl-malonsaeure-monoamid |
| Malonamic acid,2,2-diisopropyl |
| 2,2-Diisopropyl-malonamidsaeure |