Acetamide,N-(4-bromo-2-nitro-1-naphthalenyl)
Acetamide,N-(4-bromo-2-nitro-1-naphthalenyl) structure
|
Common Name | Acetamide,N-(4-bromo-2-nitro-1-naphthalenyl) | ||
|---|---|---|---|---|
| CAS Number | 7499-73-2 | Molecular Weight | 309.11500 | |
| Density | 1.674g/cm3 | Boiling Point | 510ºC at 760mmHg | |
| Molecular Formula | C12H9BrN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 262.2ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(4-bromo-2-nitronaphthalen-1-yl)acetamide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.674g/cm3 |
|---|---|
| Boiling Point | 510ºC at 760mmHg |
| Molecular Formula | C12H9BrN2O3 |
| Molecular Weight | 309.11500 |
| Flash Point | 262.2ºC |
| Exact Mass | 307.98000 |
| PSA | 74.92000 |
| LogP | 4.06510 |
| Index of Refraction | 1.715 |
| InChIKey | GHPDTOXHQCQCGM-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1c([N+](=O)[O-])cc(Br)c2ccccc12 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 10 | |
|---|---|
| DownStream 5 | |
CAS#:91394-66-0
CAS#:7664-93-9
CAS#:575-36-0
CAS#:2298-07-9
CAS#:2437-30-1
CAS#:24402-72-0![N-(4-bromo-5,8-dihydro-[1]naphthyl)-acetamide Structure](https://image.chemsrc.com/caspic/228/861798-43-8.png)
CAS#:861798-43-8
CAS#:32666-56-1![N-(4,6,7-tribromo-5,6,7,8-tetrahydro-[1]naphthyl)-acetamide Structure](https://image.chemsrc.com/caspic/099/861294-59-9.png)
CAS#:861294-59-9
CAS#:64-19-7
CAS#:74924-94-0
CAS#:7499-65-2
CAS#:905302-18-3
CAS#:90767-01-4![5-bromo-2-methyl-3H-benzo[e]benzimidazole structure](https://image.chemsrc.com/caspic/046/62148-28-1.png)
CAS#:62148-28-1This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-Brom-2-nitro-1-acetamido-naphthalin |
| 4-Brom-2-nitro-1-acetamino-naphthalin |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the downstream products of N-(4-bromo-2-nitronaphthalen-1-yl)acetamide? |
| A: Related downstream products(CAS) of N-(4-bromo-2-nitronaphthalen-1-yl)acetamide: 74924-94-0;7499-65-2;905302-18-3;90767-01-4;62148-28-1. |
| Q: What is the English name of N-(4-bromo-2-nitronaphthalen-1-yl)acetamide? |
| A: The English name of N-(4-bromo-2-nitronaphthalen-1-yl)acetamide is N-(4-bromo-2-nitronaphthalen-1-yl)acetamide. |
| Q: What is the molecular formula of N-(4-bromo-2-nitronaphthalen-1-yl)acetamide? |
| A: Molecular formula of N-(4-bromo-2-nitronaphthalen-1-yl)acetamide is C12H9BrN2O3. |
| Q: What is the boiling point of N-(4-bromo-2-nitronaphthalen-1-yl)acetamide? |
| A: Boiling point of N-(4-bromo-2-nitronaphthalen-1-yl)acetamide is 510ºC at 760mmHg. |
| Q: What is the LogP of N-(4-bromo-2-nitronaphthalen-1-yl)acetamide? |
| A: LogP of N-(4-bromo-2-nitronaphthalen-1-yl)acetamide is 4.06510. |
| Q: What is the Chinese name of 7499-73-2? |
| A: Chinese name of 7499-73-2 is 7499-73-2. |
| Q: What is the polar surface area (PSA) of N-(4-bromo-2-nitronaphthalen-1-yl)acetamide? |
| A: Polar surface area (PSA) of N-(4-bromo-2-nitronaphthalen-1-yl)acetamide is 74.92000. |
| Q: What English synonyms does N-(4-bromo-2-nitronaphthalen-1-yl)acetamide have? |
| A: English synonyms of N-(4-bromo-2-nitronaphthalen-1-yl)acetamide: 4-Brom-2-nitro-1-acetamido-naphthalin, 4-Brom-2-nitro-1-acetamino-naphthalin. |
| Q: What is the SMILES notation of N-(4-bromo-2-nitronaphthalen-1-yl)acetamide? |
| A: SMILES notation of N-(4-bromo-2-nitronaphthalen-1-yl)acetamide is CC(=O)Nc1c([N+](=O)[O-])cc(Br)c2ccccc12. |
| Q: What is the CAS number of N-(4-bromo-2-nitronaphthalen-1-yl)acetamide? |
| A: CAS number of N-(4-bromo-2-nitronaphthalen-1-yl)acetamide is 7499-73-2. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |