methyl 2-nitro-6-(thiophene-2-carbonyl)benzoate
Modify Date: 2025-08-24 17:52:17
methyl 2-nitro-6-(thiophene-2-carbonyl)benzoate structure
|
Common Name | methyl 2-nitro-6-(thiophene-2-carbonyl)benzoate | ||
|---|---|---|---|---|
| CAS Number | 7499-79-8 | Molecular Weight | 291.27900 | |
| Density | 1.408g/cm3 | Boiling Point | 426.8ºC at 760 mmHg | |
| Molecular Formula | C13H9NO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 211.9ºC | |
| Name | methyl 2-nitro-6-(thiophene-2-carbonyl)benzoate |
|---|
| Density | 1.408g/cm3 |
|---|---|
| Boiling Point | 426.8ºC at 760 mmHg |
| Molecular Formula | C13H9NO5S |
| Molecular Weight | 291.27900 |
| Flash Point | 211.9ºC |
| Exact Mass | 291.02000 |
| PSA | 117.43000 |
| LogP | 3.19710 |
| Index of Refraction | 1.621 |
| InChIKey | GEELAQBVOLROMW-UHFFFAOYSA-N |
| SMILES | COC(=O)c1c(C(=O)c2cccs2)cccc1[N+](=O)[O-] |
|
~%
methyl 2-nitro-... CAS#:7499-79-8 |
| Literature: Newman; Ihrman Journal of the American Chemical Society, 1958 , vol. 80, p. 3652,3656 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |