1,7-dimethyl-3-phenacyl-purine-2,6-dione structure
|
Common Name | 1,7-dimethyl-3-phenacyl-purine-2,6-dione | ||
|---|---|---|---|---|
| CAS Number | 7499-90-3 | Molecular Weight | 298.29700 | |
| Density | 1.38g/cm3 | Boiling Point | 564.4ºC at 760 mmHg | |
| Molecular Formula | C15H14N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 295.1ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,7-dimethyl-3-phenacylpurine-2,6-dione |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.38g/cm3 |
|---|---|
| Boiling Point | 564.4ºC at 760 mmHg |
| Molecular Formula | C15H14N4O3 |
| Molecular Weight | 298.29700 |
| Flash Point | 295.1ºC |
| Exact Mass | 298.10700 |
| PSA | 78.89000 |
| LogP | 0.31660 |
| Index of Refraction | 1.675 |
| InChIKey | UXVIDHPZCUMBBG-UHFFFAOYSA-N |
| SMILES | Cn1c(=O)c2c(ncn2C)n(CC(=O)c2ccccc2)c1=O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
1,7-dimethyl-3-... CAS#:7499-90-3 |
| Literature: Blicke; Godt Journal of the American Chemical Society, 1954 , vol. 76, p. 3653 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,7-dimethyl-3-phenacyl-3,7-dihydro-purine-2,6-dione |
| 1,7-Dimethyl-3-phenacyl-3,7-dihydro-purin-2,6-dion |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 1,7-dimethyl-3-phenacylpurine-2,6-dione? |
| A: CAS number of 1,7-dimethyl-3-phenacylpurine-2,6-dione is 7499-90-3. |
| Q: What English synonyms does 1,7-dimethyl-3-phenacylpurine-2,6-dione have? |
| A: English synonyms of 1,7-dimethyl-3-phenacylpurine-2,6-dione: 1,7-dimethyl-3-phenacyl-3,7-dihydro-purine-2,6-dione, 1,7-Dimethyl-3-phenacyl-3,7-dihydro-purin-2,6-dion. |
| Q: What is the Chinese name of 7499-90-3? |
| A: Chinese name of 7499-90-3 is 7499-90-3. |
| Q: What is the molecular formula of 1,7-dimethyl-3-phenacylpurine-2,6-dione? |
| A: Molecular formula of 1,7-dimethyl-3-phenacylpurine-2,6-dione is C15H14N4O3. |
| Q: What is the SMILES notation of 1,7-dimethyl-3-phenacylpurine-2,6-dione? |
| A: SMILES notation of 1,7-dimethyl-3-phenacylpurine-2,6-dione is Cn1c(=O)c2c(ncn2C)n(CC(=O)c2ccccc2)c1=O. |
| Q: What is the polar surface area (PSA) of 1,7-dimethyl-3-phenacylpurine-2,6-dione? |
| A: Polar surface area (PSA) of 1,7-dimethyl-3-phenacylpurine-2,6-dione is 78.89000. |
| Q: What are the upstream materials of 1,7-dimethyl-3-phenacylpurine-2,6-dione? |
| A: Related upstream materials(CAS) of 1,7-dimethyl-3-phenacylpurine-2,6-dione: 611-59-6. |
| Q: What is the LogP of 1,7-dimethyl-3-phenacylpurine-2,6-dione? |
| A: LogP of 1,7-dimethyl-3-phenacylpurine-2,6-dione is 0.31660. |
| Q: What is the InChIKey of 1,7-dimethyl-3-phenacylpurine-2,6-dione? |
| A: InChIKey of 1,7-dimethyl-3-phenacylpurine-2,6-dione is UXVIDHPZCUMBBG-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 1,7-dimethyl-3-phenacylpurine-2,6-dione? |
| A: Molecular weight of 1,7-dimethyl-3-phenacylpurine-2,6-dione is 298.29700. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |