1,7-dimethyl-3-phenacyl-purine-2,6-dione structure
|
Common Name | 1,7-dimethyl-3-phenacyl-purine-2,6-dione | ||
|---|---|---|---|---|
| CAS Number | 7499-90-3 | Molecular Weight | 298.29700 | |
| Density | 1.38g/cm3 | Boiling Point | 564.4ºC at 760 mmHg | |
| Molecular Formula | C15H14N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 295.1ºC | |
| Name | 1,7-dimethyl-3-phenacylpurine-2,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.38g/cm3 |
|---|---|
| Boiling Point | 564.4ºC at 760 mmHg |
| Molecular Formula | C15H14N4O3 |
| Molecular Weight | 298.29700 |
| Flash Point | 295.1ºC |
| Exact Mass | 298.10700 |
| PSA | 78.89000 |
| LogP | 0.31660 |
| Index of Refraction | 1.675 |
| InChIKey | UXVIDHPZCUMBBG-UHFFFAOYSA-N |
| SMILES | Cn1c(=O)c2c(ncn2C)n(CC(=O)c2ccccc2)c1=O |
|
~%
1,7-dimethyl-3-... CAS#:7499-90-3 |
| Literature: Blicke; Godt Journal of the American Chemical Society, 1954 , vol. 76, p. 3653 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1,7-dimethyl-3-phenacyl-3,7-dihydro-purine-2,6-dione |
| 1,7-Dimethyl-3-phenacyl-3,7-dihydro-purin-2,6-dion |