2-phenyl-6-pyridin-3-yl-pyran-4-one structure
|
Common Name | 2-phenyl-6-pyridin-3-yl-pyran-4-one | ||
|---|---|---|---|---|
| CAS Number | 7500-04-1 | Molecular Weight | 249.26400 | |
| Density | 1.257g/cm3 | Boiling Point | 499.9ºC at 760 mmHg | |
| Molecular Formula | C16H11NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 256.1ºC | |
| Name | 2-phenyl-6-pyridin-3-ylpyran-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.257g/cm3 |
|---|---|
| Boiling Point | 499.9ºC at 760 mmHg |
| Molecular Formula | C16H11NO2 |
| Molecular Weight | 249.26400 |
| Flash Point | 256.1ºC |
| Exact Mass | 249.07900 |
| PSA | 43.10000 |
| LogP | 3.36880 |
| Index of Refraction | 1.635 |
| InChIKey | NUCAVGBIKGUHNF-UHFFFAOYSA-N |
| SMILES | O=c1cc(-c2ccccc2)oc(-c2cccnc2)c1 |
|
~%
2-phenyl-6-pyri... CAS#:7500-04-1 |
| Literature: Light,R.J.; Hauser,C.R. Journal of Organic Chemistry, 1960 , vol. 25, p. 538 - 546 |
| 2-phenyl-6-pyridin-3-yl-pyran-4-one |
| 2-Phenyl-6-<pyridyl-(3)>-4H-pyranon-(4) |