(2Z)-2-[(2,4-dinitrophenyl)hydrazinylidene]-1,3,3-trimethyl-cyclohexan-1-ol structure
|
Common Name | (2Z)-2-[(2,4-dinitrophenyl)hydrazinylidene]-1,3,3-trimethyl-cyclohexan-1-ol | ||
|---|---|---|---|---|
| CAS Number | 7500-47-2 | Molecular Weight | 336.34300 | |
| Density | 1.386g/cm3 | Boiling Point | 478.932ºC at 760 mmHg | |
| Molecular Formula | C15H20N4O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 243.449ºC | |
| Name | (2E)-2-[(2,4-dinitrophenyl)hydrazinylidene]-1,3,3-trimethylcyclohexan-1-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.386g/cm3 |
|---|---|
| Boiling Point | 478.932ºC at 760 mmHg |
| Molecular Formula | C15H20N4O5 |
| Molecular Weight | 336.34300 |
| Flash Point | 243.449ºC |
| Exact Mass | 336.14300 |
| PSA | 136.26000 |
| LogP | 4.35140 |
| Index of Refraction | 1.621 |
| InChIKey | UIYDGEGVQUEXII-GHRIWEEISA-N |
| SMILES | CC1(C)CCCC(C)(O)C1=NNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
|
~%
(2Z)-2-[(2,4-di... CAS#:7500-47-2 |
| Literature: Stevens; Weinheimer Journal of the American Chemical Society, 1958 , vol. 80, p. 4072,4073 |
|
~%
(2Z)-2-[(2,4-di... CAS#:7500-47-2 |
| Literature: Bharucha et al. Journal of Organic Chemistry, 1954 , vol. 19, p. 1097,1103 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-Hydroxy-2,6,6-trimethyl-cyclohexanon-(2,4-dinitro-phenylhydrazon) |
| 2.5-Dimethyl-hexen-(2)-ol-(5)-on-(4) |
| 2-hydroxy-2,6,6-trimethyl-cyclohexanone-(2,4-dinitro-phenylhydrazone) |
| 4-Hexen-3-one,2-hydroxy-2,5-dimethyl |
| 2-Hydroxy-2,5-dimethyl-hex-4-en-3-on |
| 2-hydroxy-2,5-dimethyl-hex-4-en-3-one |