1-methoxy-4-[(4-nitrophenyl)methoxymethyl]benzene structure
|
Common Name | 1-methoxy-4-[(4-nitrophenyl)methoxymethyl]benzene | ||
|---|---|---|---|---|
| CAS Number | 7500-83-6 | Molecular Weight | 273.28400 | |
| Density | 1.213g/cm3 | Boiling Point | 412.8ºC at 760 mmHg | |
| Molecular Formula | C15H15NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 173.7ºC | |
| Name | 1-[(4-methoxyphenyl)methoxymethyl]-4-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.213g/cm3 |
|---|---|
| Boiling Point | 412.8ºC at 760 mmHg |
| Molecular Formula | C15H15NO4 |
| Molecular Weight | 273.28400 |
| Flash Point | 173.7ºC |
| Exact Mass | 273.10000 |
| PSA | 64.28000 |
| LogP | 3.84340 |
| Index of Refraction | 1.583 |
| InChIKey | MADCZADWKGRBFL-UHFFFAOYSA-N |
| SMILES | COc1ccc(COCc2ccc([N+](=O)[O-])cc2)cc1 |
|
~%
1-methoxy-4-[(4... CAS#:7500-83-6 |
| Literature: Pratt; Erickson Journal of the American Chemical Society, 1956 , vol. 78, p. 76 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1-methoxy-4-(4-nitro-benzyloxymethyl)-benzene |
| 1-Methoxy-4-(4-nitro-benzyloxymethyl)-benzol |