4-Chloro-2-(3-nitrophenyl)-imidazo(4,5-c)pyridine
4-Chloro-2-(3-nitrophenyl)-imidazo(4,5-c)pyridine structure
|
Common Name | 4-Chloro-2-(3-nitrophenyl)-imidazo(4,5-c)pyridine | ||
|---|---|---|---|---|
| CAS Number | 75007-82-8 | Molecular Weight | 274.66300 | |
| Density | 1.548g/cm3 | Boiling Point | 536.8ºC at 760 mmHg | |
| Molecular Formula | C12H7ClN4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 278.5ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-chloro-2-(3-nitrophenyl)-1H-imidazo[4,5-c]pyridine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.548g/cm3 |
|---|---|
| Boiling Point | 536.8ºC at 760 mmHg |
| Molecular Formula | C12H7ClN4O2 |
| Molecular Weight | 274.66300 |
| Flash Point | 278.5ºC |
| Exact Mass | 274.02600 |
| PSA | 87.39000 |
| LogP | 3.70970 |
| Index of Refraction | 1.729 |
| InChIKey | RXRRETAUSQGCQM-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc(-c2nc3c(Cl)nccc3[nH]2)c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~78%
4-Chloro-2-(3-n... CAS#:75007-82-8 |
| Literature: Middleton; Wibberley Journal of Heterocyclic Chemistry, 1980 , vol. 17, # 8 p. 1757 - 1760 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-Chloro-2-(3-nitrophenyl)-1H-imidazo(4,5-c)pyridine |
| 4-CHLORO-2-(3-NITROPHENYL)-IMIDAZO[4,5-C]PYRIDINE |
| 3H-Imidazo[4,5-c]pyridine,4-chloro-2-(3-nitrophenyl) |
| 1H-Imidazo(4,5-c)pyridine,4-chloro-2-(3-nitrophenyl) |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 4-chloro-2-(3-nitrophenyl)-1H-imidazo[4,5-c]pyridine? |
| A: CAS number of 4-chloro-2-(3-nitrophenyl)-1H-imidazo[4,5-c]pyridine is 75007-82-8. |
| Q: What is the SMILES notation of 4-chloro-2-(3-nitrophenyl)-1H-imidazo[4,5-c]pyridine? |
| A: SMILES notation of 4-chloro-2-(3-nitrophenyl)-1H-imidazo[4,5-c]pyridine is O=[N+]([O-])c1cccc(-c2nc3c(Cl)nccc3[nH]2)c1. |
| Q: What is the Chinese name of 75007-82-8? |
| A: Chinese name of 75007-82-8 is 75007-82-8. |
| Q: What are the upstream materials of 4-chloro-2-(3-nitrophenyl)-1H-imidazo[4,5-c]pyridine? |
| A: Related upstream materials(CAS) of 4-chloro-2-(3-nitrophenyl)-1H-imidazo[4,5-c]pyridine: 39217-08-8;121-92-6. |
| Q: What English synonyms does 4-chloro-2-(3-nitrophenyl)-1H-imidazo[4,5-c]pyridine have? |
| A: English synonyms of 4-chloro-2-(3-nitrophenyl)-1H-imidazo[4,5-c]pyridine: 4-Chloro-2-(3-nitrophenyl)-1H-imidazo(4,5-c)pyridine, 4-CHLORO-2-(3-NITROPHENYL)-IMIDAZO[4,5-C]PYRIDINE, 3H-Imidazo[4,5-c]pyridine,4-chloro-2-(3-nitrophenyl), 1H-Imidazo(4,5-c)pyridine,4-chloro-2-(3-nitrophenyl). |
| Q: What is the boiling point of 4-chloro-2-(3-nitrophenyl)-1H-imidazo[4,5-c]pyridine? |
| A: Boiling point of 4-chloro-2-(3-nitrophenyl)-1H-imidazo[4,5-c]pyridine is 536.8ºC at 760 mmHg. |
| Q: What is the InChIKey of 4-chloro-2-(3-nitrophenyl)-1H-imidazo[4,5-c]pyridine? |
| A: InChIKey of 4-chloro-2-(3-nitrophenyl)-1H-imidazo[4,5-c]pyridine is RXRRETAUSQGCQM-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 4-chloro-2-(3-nitrophenyl)-1H-imidazo[4,5-c]pyridine? |
| A: Molecular weight of 4-chloro-2-(3-nitrophenyl)-1H-imidazo[4,5-c]pyridine is 274.66300. |
| Q: What is the English name of 4-chloro-2-(3-nitrophenyl)-1H-imidazo[4,5-c]pyridine? |
| A: The English name of 4-chloro-2-(3-nitrophenyl)-1H-imidazo[4,5-c]pyridine is 4-chloro-2-(3-nitrophenyl)-1H-imidazo[4,5-c]pyridine. |
| Q: What is the polar surface area (PSA) of 4-chloro-2-(3-nitrophenyl)-1H-imidazo[4,5-c]pyridine? |
| A: Polar surface area (PSA) of 4-chloro-2-(3-nitrophenyl)-1H-imidazo[4,5-c]pyridine is 87.39000. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |