2-(3-Bromophenyl)-1H-imidazo(4,5-b)pyridine structure
|
Common Name | 2-(3-Bromophenyl)-1H-imidazo(4,5-b)pyridine | ||
|---|---|---|---|---|
| CAS Number | 75007-85-1 | Molecular Weight | 274.11600 | |
| Density | 1.614g/cm3 | Boiling Point | 463.1ºC at 760 mmHg | |
| Molecular Formula | C12H8BrN3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(3-bromophenyl)-1H-imidazo[4,5-b]pyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.614g/cm3 |
|---|---|
| Boiling Point | 463.1ºC at 760 mmHg |
| Molecular Formula | C12H8BrN3 |
| Molecular Weight | 274.11600 |
| Exact Mass | 272.99000 |
| PSA | 41.57000 |
| LogP | 3.38740 |
| Index of Refraction | 1.719 |
| InChIKey | QLPAEKQUGOLXLH-UHFFFAOYSA-N |
| SMILES | Brc1cccc(-c2nc3ncccc3[nH]2)c1 |
|
~86%
2-(3-Bromopheny... CAS#:75007-85-1 |
| Literature: Middleton; Wibberley Journal of Heterocyclic Chemistry, 1980 , vol. 17, # 8 p. 1757 - 1760 |
|
~85%
2-(3-Bromopheny... CAS#:75007-85-1 |
| Literature: Kale, Rajesh P.; Shaikh, Mohammad U.; Jadhav, Ganesh R.; Gill, Charansingh H. Tetrahedron Letters, 2009 , vol. 50, # 16 p. 1780 - 1782 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2-(3-Bromophenyl)-1H-imidazo(4,5-b)pyridine |
| 1H-Imidazo(4,5-b)pyridine,2-(3-bromophenyl) |