4-Chloro-2-(2-methylphenyl)-imidazo(4,5-c)pyridine structure
|
Common Name | 4-Chloro-2-(2-methylphenyl)-imidazo(4,5-c)pyridine | ||
|---|---|---|---|---|
| CAS Number | 75007-97-5 | Molecular Weight | 243.69200 | |
| Density | 1.34g/cm3 | Boiling Point | 469.7ºC at 760 mmHg | |
| Molecular Formula | C13H10ClN3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 270.1ºC | |
| Name | 4-chloro-2-(2-methylphenyl)-1H-imidazo[4,5-c]pyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.34g/cm3 |
|---|---|
| Boiling Point | 469.7ºC at 760 mmHg |
| Molecular Formula | C13H10ClN3 |
| Molecular Weight | 243.69200 |
| Flash Point | 270.1ºC |
| Exact Mass | 243.05600 |
| PSA | 41.57000 |
| LogP | 3.58670 |
| Index of Refraction | 1.683 |
| InChIKey | YSOQEAQEFGJKDE-UHFFFAOYSA-N |
| SMILES | Cc1ccccc1-c1nc2c(Cl)nccc2[nH]1 |
|
~71%
4-Chloro-2-(2-m... CAS#:75007-97-5 |
| Literature: Middleton; Wibberley Journal of Heterocyclic Chemistry, 1980 , vol. 17, # 8 p. 1757 - 1760 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-Chloro-2-(2-methylphenyl)-1H-imidazo(4,5-c)pyridine |
| 1H-Imidazo(4,5-c)pyridine,4-chloro-2-(2-methylphenyl) |
| 4-chloro-2-(2-methylphenyl)-imidazo(4,5-c)pyridine |