2-chloroethyl 3,4-dichlorobenzoate structure
|
Common Name | 2-chloroethyl 3,4-dichlorobenzoate | ||
|---|---|---|---|---|
| CAS Number | 7501-10-2 | Molecular Weight | 253.51000 | |
| Density | 1.415g/cm3 | Boiling Point | 335.3ºC at 760 mmHg | |
| Molecular Formula | C9H7Cl3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 142.3ºC | |
| Name | 2-chloroethyl 3,4-dichlorobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.415g/cm3 |
|---|---|
| Boiling Point | 335.3ºC at 760 mmHg |
| Molecular Formula | C9H7Cl3O2 |
| Molecular Weight | 253.51000 |
| Flash Point | 142.3ºC |
| Exact Mass | 251.95100 |
| PSA | 26.30000 |
| LogP | 3.38900 |
| Index of Refraction | 1.552 |
| InChIKey | GCRQSPRKGSANBG-UHFFFAOYSA-N |
| SMILES | O=C(OCCCl)c1ccc(Cl)c(Cl)c1 |
|
~%
2-chloroethyl 3... CAS#:7501-10-2 |
| Literature: Woodburn; Sroog Journal of the American Chemical Society, 1949 , vol. 71, p. 1709 |
|
~%
2-chloroethyl 3... CAS#:7501-10-2 |
| Literature: Woodburn; Sroog Journal of the American Chemical Society, 1949 , vol. 71, p. 1709 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 3,4-dichloro-benzoic acid-(2-chloro-ethyl ester) |
| 3,4-Dichlor-benzoesaeure-(2-chlor-aethylester) |