1-methyl-7-propan-2-yl-tetralin-1-ol structure
|
Common Name | 1-methyl-7-propan-2-yl-tetralin-1-ol | ||
|---|---|---|---|---|
| CAS Number | 7501-40-8 | Molecular Weight | 204.30800 | |
| Density | 1.012g/cm3 | Boiling Point | 296.1ºC at 760 mmHg | |
| Molecular Formula | C14H20O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 120.7ºC | |
| Name | 1-methyl-7-propan-2-yl-3,4-dihydro-2H-naphthalen-1-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.012g/cm3 |
|---|---|
| Boiling Point | 296.1ºC at 760 mmHg |
| Molecular Formula | C14H20O |
| Molecular Weight | 204.30800 |
| Flash Point | 120.7ºC |
| Exact Mass | 204.15100 |
| PSA | 20.23000 |
| LogP | 3.35380 |
| Index of Refraction | 1.541 |
| InChIKey | AROKXUYHEOQGNX-UHFFFAOYSA-N |
| SMILES | CC(C)c1ccc2c(c1)C(C)(O)CCC2 |
|
~%
1-methyl-7-prop... CAS#:7501-40-8 |
| Literature: Barnett; Sanders Journal of the Chemical Society, 1933 , p. 434,436 |
|
~%
1-methyl-7-prop... CAS#:7501-40-8 |
| Literature: Barnett; Sanders Journal of the Chemical Society, 1933 , p. 434,436 |
|
~%
1-methyl-7-prop... CAS#:7501-40-8 |
| Literature: Barnett; Sanders Journal of the Chemical Society, 1933 , p. 434,436 |
|
~%
1-methyl-7-prop... CAS#:7501-40-8 |
| Literature: Barnett; Sanders Journal of the Chemical Society, 1933 , p. 434,436 |
| 7-Isopropyl-1-methyl-1,2,3,4-tetrahydro-[1]naphthol |
| (+-)-1-Hydroxy-1-methyl-7-isopropyl-1.2.3.4-tetrahydro-naphthalin |
| 1-Methyl-7-isopropyl-1,2,3,4-tetrahydronaphthalin-1-ol |
| (+-)-1-Hydroxy-1-methyl-7-isopropyl-tetralin |