4-[chloro-(4-hydroxy-3-nitro-phenyl)arsanyl]-2-nitro-phenol structure
|
Common Name | 4-[chloro-(4-hydroxy-3-nitro-phenyl)arsanyl]-2-nitro-phenol | ||
|---|---|---|---|---|
| CAS Number | 7501-73-7 | Molecular Weight | 386.57600 | |
| Density | N/A | Boiling Point | 499.7ºC at 760 mmHg | |
| Molecular Formula | C12H8AsClN2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 256ºC | |
| Name | 4-[chloro-(4-hydroxy-3-nitrophenyl)arsanyl]-2-nitrophenol |
|---|
| Boiling Point | 499.7ºC at 760 mmHg |
|---|---|
| Molecular Formula | C12H8AsClN2O6 |
| Molecular Weight | 386.57600 |
| Flash Point | 256ºC |
| Exact Mass | 385.92900 |
| PSA | 132.10000 |
| LogP | 2.30510 |
| InChIKey | VJWOJDBMYNTQKV-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc([As](Cl)c2ccc(O)c([N+](=O)[O-])c2)ccc1O |
|
~%
4-[chloro-(4-hy... CAS#:7501-73-7 |
| Literature: Blicke; Oneto; Webster Journal of the American Chemical Society, 1937 , vol. 59, p. 925 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |