Benzoic acid,3-nitro-2-propoxy- structure
|
Common Name | Benzoic acid,3-nitro-2-propoxy- | ||
|---|---|---|---|---|
| CAS Number | 75024-21-4 | Molecular Weight | 225.19800 | |
| Density | 1.318g/cm3 | Boiling Point | 388.7ºC at 760 mmHg | |
| Molecular Formula | C10H11NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 188.9ºC | |
| Name | 3-nitro-2-propoxybenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.318g/cm3 |
|---|---|
| Boiling Point | 388.7ºC at 760 mmHg |
| Molecular Formula | C10H11NO5 |
| Molecular Weight | 225.19800 |
| Flash Point | 188.9ºC |
| Exact Mass | 225.06400 |
| PSA | 92.35000 |
| LogP | 2.60500 |
| Index of Refraction | 1.565 |
| InChIKey | SYFPIQBALPNLAJ-UHFFFAOYSA-N |
| SMILES | CCCOc1c(C(=O)O)cccc1[N+](=O)[O-] |
|
~%
Benzoic acid,3-... CAS#:75024-21-4 |
| Literature: Epstein; Meyer Journal of the American Chemical Society, 1955 , vol. 77, p. 4059 |
|
~%
Benzoic acid,3-... CAS#:75024-21-4 |
| Literature: Sterling Drug Inc. Patent: US2882296 , 1952 ; |
| Benzoic acid,3-nitro-2-propoxy |
| 3-Nitro-2-propoxy-benzoesaeure |
| 3-nitro-2-propoxy-benzoic acid |