methyl 4-acenaphthen-5-yl-4-oxo-butanoate structure
|
Common Name | methyl 4-acenaphthen-5-yl-4-oxo-butanoate | ||
|---|---|---|---|---|
| CAS Number | 7504-38-3 | Molecular Weight | 268.30700 | |
| Density | 1.222g/cm3 | Boiling Point | 472.3ºC at 760 mmHg | |
| Molecular Formula | C17H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 211.6ºC | |
| Name | methyl 4-(1,2-dihydroacenaphthylen-5-yl)-4-oxobutanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.222g/cm3 |
|---|---|
| Boiling Point | 472.3ºC at 760 mmHg |
| Molecular Formula | C17H16O3 |
| Molecular Weight | 268.30700 |
| Flash Point | 211.6ºC |
| Exact Mass | 268.11000 |
| PSA | 43.37000 |
| LogP | 3.07430 |
| Index of Refraction | 1.622 |
| InChIKey | FQIDWHIAQSZKLO-UHFFFAOYSA-N |
| SMILES | COC(=O)CCC(=O)c1ccc2c3c(cccc13)CC2 |
|
~%
methyl 4-acenap... CAS#:7504-38-3 |
| Literature: Fieser; Peters Journal of the American Chemical Society, 1932 , vol. 54, p. 4347,4355 |
|
~%
methyl 4-acenap... CAS#:7504-38-3 |
| Literature: Fieser; Peters Journal of the American Chemical Society, 1932 , vol. 54, p. 4347,4355 |
| METHYL 4-ACENAPHTHEN-5-YL-4-OXO-BUTANOATE |
| 4-Acenaphthen-5-yl-4-oxo-buttersaeure-methylester |
| 4-acenaphthen-5-yl-4-oxo-butyric acid methyl ester |