4-ethyl-4-(trichloromethyl)cyclohexa-2,5-dien-1-one structure
|
Common Name | 4-ethyl-4-(trichloromethyl)cyclohexa-2,5-dien-1-one | ||
|---|---|---|---|---|
| CAS Number | 7504-39-4 | Molecular Weight | 239.52600 | |
| Density | 1.357g/cm3 | Boiling Point | 304.6ºC at 760 mmHg | |
| Molecular Formula | C9H9Cl3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 127.7ºC | |
| Name | 4-ethyl-4-(trichloromethyl)cyclohexa-2,5-dien-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.357g/cm3 |
|---|---|
| Boiling Point | 304.6ºC at 760 mmHg |
| Molecular Formula | C9H9Cl3O |
| Molecular Weight | 239.52600 |
| Flash Point | 127.7ºC |
| Exact Mass | 237.97200 |
| PSA | 17.07000 |
| LogP | 3.44810 |
| Index of Refraction | 1.536 |
| InChIKey | HMZDOYSWUSEWPI-UHFFFAOYSA-N |
| SMILES | CCC1(C(Cl)(Cl)Cl)C=CC(=O)C=C1 |
|
~%
4-ethyl-4-(tric... CAS#:7504-39-4 |
| Literature: Merchant,J.R.; Desai,V.B. Journal of the Chemical Society, 1964 , p. 2258 - 2261 |
| 4-Ethyl-4-trichlormethyl-cyclohexa-2,5-dien-1-on |