[5-(6-aminopurin-9-yl)-3-chloro-4-ethylsulfanyl-oxolan-2-yl]methanol structure
|
Common Name | [5-(6-aminopurin-9-yl)-3-chloro-4-ethylsulfanyl-oxolan-2-yl]methanol | ||
|---|---|---|---|---|
| CAS Number | 7504-53-2 | Molecular Weight | 329.80600 | |
| Density | 1.74g/cm3 | Boiling Point | 631.8ºC at 760 mmHg | |
| Molecular Formula | C12H16ClN5O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 335.9ºC | |
| Name | [5-(6-aminopurin-9-yl)-3-chloro-4-ethylsulfanyloxolan-2-yl]methanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.74g/cm3 |
|---|---|
| Boiling Point | 631.8ºC at 760 mmHg |
| Molecular Formula | C12H16ClN5O2S |
| Molecular Weight | 329.80600 |
| Flash Point | 335.9ºC |
| Exact Mass | 329.07100 |
| PSA | 124.38000 |
| LogP | 1.60850 |
| Index of Refraction | 1.786 |
| InChIKey | KTZPAPRBKPCISC-UHFFFAOYSA-N |
| SMILES | CCSC1C(Cl)C(CO)OC1n1cnc2c(N)ncnc21 |
|
~%
[5-(6-aminopuri... CAS#:7504-53-2 |
| Literature: Anderson et al. Journal of the American Chemical Society, 1959 , vol. 81, p. 3967,3972 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| [5-(6-aminopurin-9-yl)-3-chloro-4-ethylsulfanyl-oxolan-2-yl]methanol |