2,5-bis(2-chlorophenyl)-1,1-dioxo-thiophene-3,4-diol structure
|
Common Name | 2,5-bis(2-chlorophenyl)-1,1-dioxo-thiophene-3,4-diol | ||
|---|---|---|---|---|
| CAS Number | 7504-78-1 | Molecular Weight | 369.21900 | |
| Density | 1.677g/cm3 | Boiling Point | 539.9ºC at 760 mmHg | |
| Molecular Formula | C16H10Cl2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 280.3ºC | |
| Name | 2,5-bis(2-chlorophenyl)-1,1-dioxothiophene-3,4-diol |
|---|
| Density | 1.677g/cm3 |
|---|---|
| Boiling Point | 539.9ºC at 760 mmHg |
| Molecular Formula | C16H10Cl2O4S |
| Molecular Weight | 369.21900 |
| Flash Point | 280.3ºC |
| Exact Mass | 367.96800 |
| PSA | 82.98000 |
| LogP | 5.65600 |
| Index of Refraction | 1.735 |
| InChIKey | ULIHRPBVESNGFO-UHFFFAOYSA-N |
| SMILES | O=S1(=O)C(c2ccccc2Cl)=C(O)C(O)=C1c1ccccc1Cl |
|
~%
2,5-bis(2-chlor... CAS#:7504-78-1 |
| Literature: Overberger et al. Journal of the American Chemical Society, 1953 , vol. 75, p. 2075 |
|
~%
2,5-bis(2-chlor... CAS#:7504-78-1 |
| Literature: Overberger et al. Journal of the American Chemical Society, 1953 , vol. 75, p. 2075 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |