2-(1-methyl-2,3,4,5-tetrahydropyrrol-1-yl)-1-phenyl-ethanol structure
|
Common Name | 2-(1-methyl-2,3,4,5-tetrahydropyrrol-1-yl)-1-phenyl-ethanol | ||
|---|---|---|---|---|
| CAS Number | 7504-95-2 | Molecular Weight | 333.20800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H20INO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(1-methylpyrrolidin-1-ium-1-yl)-1-phenylethanol,iodide |
|---|
| Molecular Formula | C13H20INO |
|---|---|
| Molecular Weight | 333.20800 |
| Exact Mass | 333.05900 |
| PSA | 20.23000 |
| InChIKey | UVOUKVABIIHYQD-UHFFFAOYSA-M |
| SMILES | C[N+]1(CC(O)c2ccccc2)CCCC1.[I-] |
|
~%
2-(1-methyl-2,3... CAS#:7504-95-2 |
| Literature: Moehre, H.; Kamper, Ch. Pharmazie, 1983 , vol. 38, # 8 p. 512 - 520 |
|
~%
2-(1-methyl-2,3... CAS#:7504-95-2 |
| Literature: Bahner et al. Journal of the American Chemical Society, 1951 , vol. 73, p. 4455 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |