N-(2,2-dimethylpropyl)-N-(6-methoxyquinolin-8-yl)ethane-1,2-diamine structure
|
Common Name | N-(2,2-dimethylpropyl)-N-(6-methoxyquinolin-8-yl)ethane-1,2-diamine | ||
|---|---|---|---|---|
| CAS Number | 7505-22-8 | Molecular Weight | 287.40000 | |
| Density | 1.071g/cm3 | Boiling Point | 453.4ºC at 760 mmHg | |
| Molecular Formula | C17H25N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 228ºC | |
| Name | N-(2,2-dimethylpropyl)-N'-(6-methoxyquinolin-8-yl)ethane-1,2-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.071g/cm3 |
|---|---|
| Boiling Point | 453.4ºC at 760 mmHg |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.40000 |
| Flash Point | 228ºC |
| Exact Mass | 287.20000 |
| PSA | 46.18000 |
| LogP | 3.75490 |
| Index of Refraction | 1.584 |
| InChIKey | JITJMTHXJSVHNR-UHFFFAOYSA-N |
| SMILES | COc1cc(NCCNCC(C)(C)C)c2ncccc2c1 |
|
~%
N-(2,2-dimethyl... CAS#:7505-22-8 |
| Literature: Drake et al. Journal of the American Chemical Society, 1949 , vol. 71, p. 455,457 |
|
~%
N-(2,2-dimethyl... CAS#:7505-22-8 |
| Literature: Drake et al. Journal of the American Chemical Society, 1949 , vol. 71, p. 455,457 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N-(6-methoxy-[8]quinolyl)-N'-neopentyl-ethylenediamine |
| N-(6-Methoxy-[8]chinolyl)-N'-neopentyl-aethylendiamin |