3,3-diethyl-3,6-diazoniaspiro[5.7]tridecane structure
|
Common Name | 3,3-diethyl-3,6-diazoniaspiro[5.7]tridecane | ||
|---|---|---|---|---|
| CAS Number | 7506-04-9 | Molecular Weight | 320.33200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H32BrN2+ | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,3-diethyl-3,6-diazoniaspiro[5.7]tridecane,bromide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H32BrN2+ |
|---|---|
| Molecular Weight | 320.33200 |
| Exact Mass | 319.17500 |
| InChIKey | QWBPTUOGVBRLFC-UHFFFAOYSA-M |
| SMILES | CC[N+]1(CC)CC[N+]2(CCCCCCC2)CC1.[Br-] |
|
~%
3,3-diethyl-3,6... CAS#:7506-04-9 |
| Literature: Blicke; Hotelling Journal of the American Chemical Society, 1954 , vol. 76, p. 2427 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3,3-Diaethyl-3,6-diazonia-spiro[5.7]tridecan,Dibromid |
| 3,3-diethyl-3,6-diazonia-spiro[5.7]tridecane,dibromide |