1H-Isoindole-1,3(2H)-dione,2-[[(4-methoxyphenyl)amino]methyl]- structure
|
Common Name | 1H-Isoindole-1,3(2H)-dione,2-[[(4-methoxyphenyl)amino]methyl]- | ||
|---|---|---|---|---|
| CAS Number | 7506-37-8 | Molecular Weight | 282.29400 | |
| Density | 1.334g/cm3 | Boiling Point | 484ºC at 760 mmHg | |
| Molecular Formula | C16H14N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 246.5ºC | |
| Name | 2-[(4-methoxyanilino)methyl]isoindole-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.334g/cm3 |
|---|---|
| Boiling Point | 484ºC at 760 mmHg |
| Molecular Formula | C16H14N2O3 |
| Molecular Weight | 282.29400 |
| Flash Point | 246.5ºC |
| Exact Mass | 282.10000 |
| PSA | 58.64000 |
| LogP | 2.37170 |
| Index of Refraction | 1.661 |
| InChIKey | NBPCFJQUQFKOHN-UHFFFAOYSA-N |
| SMILES | COc1ccc(NCN2C(=O)c3ccccc3C2=O)cc1 |
| HS Code | 2925190090 |
|---|
|
~%
1H-Isoindole-1,... CAS#:7506-37-8 |
| Literature: Winstead; Heine Journal of the American Chemical Society, 1955 , vol. 77, p. 1913 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-{[(4-methoxyphenyl)amino]methyl}-1H-isoindole-1,3(2H)-dione |
| HMS1608G01 |
| F0777-0692 |
| N-<4-Methoxy-anilinomethyl>-phthalimid |
| N-p-anisidinomethyl-phthalimide |