Benzeneacetamide, a-methoxy-N-(4-methylphenyl)-a-phenyl- structure
|
Common Name | Benzeneacetamide, a-methoxy-N-(4-methylphenyl)-a-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 7506-38-9 | Molecular Weight | 331.40800 | |
| Density | 1.157g/cm3 | Boiling Point | 517.7ºC at 760 mmHg | |
| Molecular Formula | C22H21NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 266.9ºC | |
| Name | 2-methoxy-N-(4-methylphenyl)-2,2-diphenylacetamide |
|---|
| Density | 1.157g/cm3 |
|---|---|
| Boiling Point | 517.7ºC at 760 mmHg |
| Molecular Formula | C22H21NO2 |
| Molecular Weight | 331.40800 |
| Flash Point | 266.9ºC |
| Exact Mass | 331.15700 |
| PSA | 38.33000 |
| LogP | 4.59670 |
| Index of Refraction | 1.617 |
| InChIKey | YDCDBWHNYHEIEO-UHFFFAOYSA-N |
| SMILES | COC(C(=O)Nc1ccc(C)cc1)(c1ccccc1)c1ccccc1 |
|
~30%
Detail
|
| Literature: Perumal, Subramoniam I.; Barker, Marvin W. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1980 , vol. 19, # 6 p. 508 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |