Benzamide,2,4-dichloro-N-(2-methoxyphenyl)- structure
|
Common Name | Benzamide,2,4-dichloro-N-(2-methoxyphenyl)- | ||
|---|---|---|---|---|
| CAS Number | 7506-47-0 | Molecular Weight | 296.14900 | |
| Density | 1.369g/cm3 | Boiling Point | 362.6ºC at 760mmHg | |
| Molecular Formula | C14H11Cl2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 173.1ºC | |
| Name | 2,4-dichloro-N-(2-methoxyphenyl)benzamide |
|---|
| Density | 1.369g/cm3 |
|---|---|
| Boiling Point | 362.6ºC at 760mmHg |
| Molecular Formula | C14H11Cl2NO2 |
| Molecular Weight | 296.14900 |
| Flash Point | 173.1ºC |
| Exact Mass | 295.01700 |
| PSA | 38.33000 |
| LogP | 4.32730 |
| Index of Refraction | 1.633 |
| InChIKey | ZIVGZESHZQWYBP-UHFFFAOYSA-N |
| SMILES | COc1ccccc1NC(=O)c1ccc(Cl)cc1Cl |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |