2-(3-Bromophenyl)-thiazole-4-carbaldehyde structure
|
Common Name | 2-(3-Bromophenyl)-thiazole-4-carbaldehyde | ||
|---|---|---|---|---|
| CAS Number | 750624-69-2 | Molecular Weight | 268.13000 | |
| Density | 1.622g/cm3 | Boiling Point | 407.455ºC at 760 mmHg | |
| Molecular Formula | C10H6BrNOS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 200.222ºC | |
| Name | 2-(3-bromophenyl)-1,3-thiazole-4-carbaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.622g/cm3 |
|---|---|
| Boiling Point | 407.455ºC at 760 mmHg |
| Molecular Formula | C10H6BrNOS |
| Molecular Weight | 268.13000 |
| Flash Point | 200.222ºC |
| Exact Mass | 266.93500 |
| PSA | 58.20000 |
| LogP | 3.38510 |
| Index of Refraction | 1.67 |
| InChIKey | YNXSRZKASQSOPO-UHFFFAOYSA-N |
| SMILES | O=Cc1csc(-c2cccc(Br)c2)n1 |
| HS Code | 2934100090 |
|---|
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| MFCD06337054 |