2-(3,4-Dimethyl-phenoxy)-2-methyl-propionic acid structure
|
Common Name | 2-(3,4-Dimethyl-phenoxy)-2-methyl-propionic acid | ||
|---|---|---|---|---|
| CAS Number | 75066-24-9 | Molecular Weight | 208.25400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(3,4-Dimethyl-phenoxy)-2-methyl-propionic acid |
|---|
| Molecular Formula | C12H16O3 |
|---|---|
| Molecular Weight | 208.25400 |
| Exact Mass | 208.11000 |
| PSA | 46.53000 |
| LogP | 2.54540 |
| InChIKey | YQKAJORFGHOODL-UHFFFAOYSA-N |
| SMILES | Cc1ccc(OC(C)(C)C(=O)O)cc1C |
| HS Code | 2918990090 |
|---|
|
~84%
2-(3,4-Dimethyl... CAS#:75066-24-9 |
| Literature: Islam, M. Majharul; Waring, Anthony J. Journal of Chemical Research, Miniprint, 1980 , # 2 p. 768 - 783 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |