3-Benzylthiazolium Bromide structure
|
Common Name | 3-Benzylthiazolium Bromide | ||
|---|---|---|---|---|
| CAS Number | 75066-50-1 | Molecular Weight | 256.16200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H10BrNS | Melting Point | 158 °C | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-Benzylthiazolium Bromide |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 158 °C |
|---|---|
| Molecular Formula | C10H10BrNS |
| Molecular Weight | 256.16200 |
| Exact Mass | 254.97200 |
| PSA | 32.12000 |
| InChIKey | BVVXTLWKNXVYDS-UHFFFAOYSA-M |
| SMILES | [Br-].c1ccc(C[n+]2ccsc2)cc1 |
| HS Code | 2934100090 |
|---|
|
~%
3-Benzylthiazol... CAS#:75066-50-1 |
| Literature: Journal of Organic Chemistry, , vol. 45, # 24 p. 4947 - 4952 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 3-benzyl-1,3-thiazol-3-ium,bromide |