Nonanedioic acid, 1,9-bis[3-(tetrahydro-2-furanyl)propyl] ester structure
|
Common Name | Nonanedioic acid, 1,9-bis[3-(tetrahydro-2-furanyl)propyl] ester | ||
|---|---|---|---|---|
| CAS Number | 7507-11-1 | Molecular Weight | 412.56000 | |
| Density | 1.045g/cm3 | Boiling Point | 498.1ºC at 760mmHg | |
| Molecular Formula | C23H40O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 211.4ºC | |
| Name | bis[3-(oxolan-2-yl)propyl] nonanedioate |
|---|
| Density | 1.045g/cm3 |
|---|---|
| Boiling Point | 498.1ºC at 760mmHg |
| Molecular Formula | C23H40O6 |
| Molecular Weight | 412.56000 |
| Flash Point | 211.4ºC |
| Exact Mass | 412.28200 |
| PSA | 71.06000 |
| LogP | 4.72190 |
| Index of Refraction | 1.475 |
| InChIKey | IDUZRQQUVSIVCT-UHFFFAOYSA-N |
| SMILES | O=C(CCCCCCCC(=O)OCCCC1CCCO1)OCCCC1CCCO1 |
|
~%
Nonanedioic aci... CAS#:7507-11-1 |
| Literature: Russell et al. Journal of the American Chemical Society, 1953 , vol. 75, p. 2161 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |