Nonanoic acid,1-[2-(tetrahydro-2-furanyl)ethyl]-1,4,7-heptanetriyl ester (9CI) structure
|
Common Name | Nonanoic acid,1-[2-(tetrahydro-2-furanyl)ethyl]-1,4,7-heptanetriyl ester (9CI) | ||
|---|---|---|---|---|
| CAS Number | 7507-17-7 | Molecular Weight | 667.01100 | |
| Density | 0.967g/cm3 | Boiling Point | 692ºC at 760mmHg | |
| Molecular Formula | C40H74O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 273.1ºC | |
| Name | [4,7-di(nonanoyloxy)-9-(oxolan-2-yl)nonyl] nonanoate |
|---|
| Density | 0.967g/cm3 |
|---|---|
| Boiling Point | 692ºC at 760mmHg |
| Molecular Formula | C40H74O7 |
| Molecular Weight | 667.01100 |
| Flash Point | 273.1ºC |
| Exact Mass | 666.54300 |
| PSA | 88.13000 |
| LogP | 11.12460 |
| Index of Refraction | 1.469 |
| InChIKey | WUURZQFSQXBKEF-UHFFFAOYSA-N |
| SMILES | CCCCCCCCC(=O)OCCCC(CCC(CCC1CCCO1)OC(=O)CCCCCCCC)OC(=O)CCCCCCCC |
|
~%
Nonanoic acid,1... CAS#:7507-17-7 |
| Literature: Russell et al. Journal of the American Chemical Society, 1953 , vol. 75, p. 726 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |