9H-Fluorene-2-carboxylicacid structure
|
Common Name | 9H-Fluorene-2-carboxylicacid | ||
|---|---|---|---|---|
| CAS Number | 7507-40-6 | Molecular Weight | 210.22800 | |
| Density | 1.306g/cm3 | Boiling Point | 429.4ºC at 760 mmHg | |
| Molecular Formula | C14H10O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191.2ºC | |
| Name | 9h-fluorene-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.306g/cm3 |
|---|---|
| Boiling Point | 429.4ºC at 760 mmHg |
| Molecular Formula | C14H10O2 |
| Molecular Weight | 210.22800 |
| Flash Point | 191.2ºC |
| Exact Mass | 210.06800 |
| PSA | 37.30000 |
| LogP | 2.95600 |
| Index of Refraction | 1.679 |
| InChIKey | IBIDFEWDKNJSRD-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc2c(c1)Cc1ccccc1-2 |
| HS Code | 2916399090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 5 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-carboxyfluorene |
| Fluoren-2-carbonsaeure |
| 2-fluorenylcarboxylic acid |
| Fluorene-2-carboxylic acid |
| 2-fluorenecarboxylic acid |