4-methyl-N-(9-oxofluoren-2-yl)benzenesulfonamide structure
|
Common Name | 4-methyl-N-(9-oxofluoren-2-yl)benzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 7507-52-0 | Molecular Weight | 349.40300 | |
| Density | 1.396g/cm3 | Boiling Point | 561.3ºC at 760 mmHg | |
| Molecular Formula | C20H15NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 293.2ºC | |
| Name | 4-methyl-N-(9-oxofluoren-2-yl)benzenesulfonamide |
|---|
| Density | 1.396g/cm3 |
|---|---|
| Boiling Point | 561.3ºC at 760 mmHg |
| Molecular Formula | C20H15NO3S |
| Molecular Weight | 349.40300 |
| Flash Point | 293.2ºC |
| Exact Mass | 349.07700 |
| PSA | 71.62000 |
| LogP | 5.16100 |
| Index of Refraction | 1.692 |
| InChIKey | QDTDLVFOJQOBCW-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc3c(c2)C(=O)c2ccccc2-3)cc1 |
| HS Code | 2935009090 |
|---|
|
~%
4-methyl-N-(9-o... CAS#:7507-52-0 |
| Literature: Fletcher et al. Journal of Organic Chemistry, 1955 , vol. 20, p. 1021,1023 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |