1,3,5-tris(4-nitrophenyl)-1,3,5-triazinane structure
|
Common Name | 1,3,5-tris(4-nitrophenyl)-1,3,5-triazinane | ||
|---|---|---|---|---|
| CAS Number | 7507-66-6 | Molecular Weight | 450.40400 | |
| Density | 1.463g/cm3 | Boiling Point | 712ºC at 760 mmHg | |
| Molecular Formula | C21H18N6O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 384.4ºC | |
| Name | 1,3,5-tris(4-nitrophenyl)-1,3,5-triazinane |
|---|
| Density | 1.463g/cm3 |
|---|---|
| Boiling Point | 712ºC at 760 mmHg |
| Molecular Formula | C21H18N6O6 |
| Molecular Weight | 450.40400 |
| Flash Point | 384.4ºC |
| Exact Mass | 450.12900 |
| PSA | 147.18000 |
| LogP | 5.88150 |
| Index of Refraction | 1.689 |
| InChIKey | YOQXJHPQCLZWKX-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(N2CN(c3ccc([N+](=O)[O-])cc3)CN(c3ccc([N+](=O)[O-])cc3)C2)cc1 |
|
~77%
1,3,5-tris(4-ni... CAS#:7507-66-6 |
| Literature: Wu, Hui; Yuan, Rui; Wan, Yu; Yin, Wei; Pang, Li-Ling Asian Journal of Chemistry, 2010 , vol. 22, # 2 p. 1097 - 1102 |
|
~63%
1,3,5-tris(4-ni... CAS#:7507-66-6 |
| Literature: Ghandi, Mehdi; Salimi, Farshid; Olyaei, Abolfazl Molecules, 2006 , vol. 11, # 7 p. 556 - 563 |