Piperidinium,1,1,4-trimethyl-3-oxo-4-phenyl-, bromide (1:1) structure
|
Common Name | Piperidinium,1,1,4-trimethyl-3-oxo-4-phenyl-, bromide (1:1) | ||
|---|---|---|---|---|
| CAS Number | 7507-69-9 | Molecular Weight | 298.21900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H20BrNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,1,4-trimethyl-4-phenylpiperidin-1-ium-3-one,bromide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H20BrNO |
|---|---|
| Molecular Weight | 298.21900 |
| Exact Mass | 297.07300 |
| PSA | 17.07000 |
| InChIKey | JMRXFNUDJPEEGC-UHFFFAOYSA-M |
| SMILES | CC1(c2ccccc2)CC[N+](C)(C)CC1=O.[Br-] |
|
~%
Piperidinium,1,... CAS#:7507-69-9 |
| Literature: Blicke; Krapcho Journal of the American Chemical Society, 1952 , vol. 74, p. 4001,4002 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1,1,4-trimethyl-3-oxo-4-phenyl-piperidinium,bromir |