Ethanone,2-chloro-1-(2-hydroxy-3,4-dimethoxyphenyl)- structure
|
Common Name | Ethanone,2-chloro-1-(2-hydroxy-3,4-dimethoxyphenyl)- | ||
|---|---|---|---|---|
| CAS Number | 7507-92-8 | Molecular Weight | 230.64500 | |
| Density | 1.29g/cm3 | Boiling Point | 350.2ºC at 760 mmHg | |
| Molecular Formula | C10H11ClO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 165.6ºC | |
| Name | 2-chloro-1-(2-hydroxy-3,4-dimethoxyphenyl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.29g/cm3 |
|---|---|
| Boiling Point | 350.2ºC at 760 mmHg |
| Molecular Formula | C10H11ClO4 |
| Molecular Weight | 230.64500 |
| Flash Point | 165.6ºC |
| Exact Mass | 230.03500 |
| PSA | 55.76000 |
| LogP | 1.83090 |
| Index of Refraction | 1.543 |
| InChIKey | COSMZALMZMAWDG-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)CCl)c(O)c1OC |
|
~69%
Ethanone,2-chlo... CAS#:7507-92-8 |
| Literature: Nore; Honkanen Journal of Heterocyclic Chemistry, 1980 , vol. 17, # 5 p. 985 - 987 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 2-Chlor-1-(2-hydroxy-3,4-dimethoxy-phenyl)-aethanon |
| 2-chloro-1-(2-hydroxy-3,4-dimethoxy-phenyl)-ethanone |
| 2-chloro-1-(2-hydroxy-3,4-dimethoxyphenyl)ethan-1-one |
| 2-Chloro-2'-hydroxy-3',4'-dimethoxyacetophenone |