4,5,6-trimethoxy-2-methyl-isoindole-1,3-dione structure
|
Common Name | 4,5,6-trimethoxy-2-methyl-isoindole-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 7508-01-2 | Molecular Weight | 251.23500 | |
| Density | 1.291g/cm3 | Boiling Point | 403ºC at 760 mmHg | |
| Molecular Formula | C12H13NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 197.5ºC | |
| Name | 4,5,6-trimethoxy-2-methylisoindole-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.291g/cm3 |
|---|---|
| Boiling Point | 403ºC at 760 mmHg |
| Molecular Formula | C12H13NO5 |
| Molecular Weight | 251.23500 |
| Flash Point | 197.5ºC |
| Exact Mass | 251.07900 |
| PSA | 65.07000 |
| LogP | 0.87610 |
| Index of Refraction | 1.554 |
| InChIKey | KMGZQIIQHARLKL-UHFFFAOYSA-N |
| SMILES | COc1cc2c(c(OC)c1OC)C(=O)N(C)C2=O |
|
~%
4,5,6-trimethox... CAS#:7508-01-2 |
| Literature: Manske; Holmes Journal of the American Chemical Society, 1945 , vol. 67, p. 95,97 |
|
~%
4,5,6-trimethox... CAS#:7508-01-2 |
| Literature: Manske; Holmes Journal of the American Chemical Society, 1945 , vol. 67, p. 95,97 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 4,5,6-Trimethoxy-2-methyl-isoindolin-1,3-dion |
| 4,5,6-trimethoxy-2-methyl-isoindoline-1,3-dione |
| 3,4,5-Trimethoxy-N-methylphthalimid |
| 4,5,6-trimethoxy-2-methyl-isoindole-1,3-dione |