5-(3,4-dimethylphenyl)-5-oxo-pentanoic acid structure
|
Common Name | 5-(3,4-dimethylphenyl)-5-oxo-pentanoic acid | ||
|---|---|---|---|---|
| CAS Number | 7508-13-6 | Molecular Weight | 220.26400 | |
| Density | 1.114g/cm3 | Boiling Point | 418.3ºC at 760 mmHg | |
| Molecular Formula | C13H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 220.9ºC | |
| Name | 5-(3,4-dimethylphenyl)-5-oxopentanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.114g/cm3 |
|---|---|
| Boiling Point | 418.3ºC at 760 mmHg |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.26400 |
| Flash Point | 220.9ºC |
| Exact Mass | 220.11000 |
| PSA | 54.37000 |
| LogP | 2.74100 |
| Index of Refraction | 1.533 |
| InChIKey | PYNCEAUAQBMUKU-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(=O)CCCC(=O)O)cc1C |
| HS Code | 2918300090 |
|---|
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 5-(3,4-Dimethyl-phenyl)-5-oxo-valeriansaeure |
| 5-(3,4-dimethyl-phenyl)-5-oxo-valeric acid |