(4-chlorophenyl)-(2-hydroxy-3,4-dimethoxy-phenyl)methanone structure
|
Common Name | (4-chlorophenyl)-(2-hydroxy-3,4-dimethoxy-phenyl)methanone | ||
|---|---|---|---|---|
| CAS Number | 7508-29-4 | Molecular Weight | 292.71400 | |
| Density | 1.295g/cm3 | Boiling Point | 427.1ºC at 760 mmHg | |
| Molecular Formula | C15H13ClO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 212.1ºC | |
| Name | (4-chlorophenyl)-(2-hydroxy-3,4-dimethoxyphenyl)methanone |
|---|
| Density | 1.295g/cm3 |
|---|---|
| Boiling Point | 427.1ºC at 760 mmHg |
| Molecular Formula | C15H13ClO4 |
| Molecular Weight | 292.71400 |
| Flash Point | 212.1ºC |
| Exact Mass | 292.05000 |
| PSA | 55.76000 |
| LogP | 3.29380 |
| Index of Refraction | 1.589 |
| InChIKey | PQLXTWORZZAKOC-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)c2ccc(Cl)cc2)c(O)c1OC |
|
~53%
(4-chlorophenyl... CAS#:7508-29-4 |
| Literature: Sato; Dan; Onuma; Tanaka; Aoki; Koga Chemical and Pharmaceutical Bulletin, 1992 , vol. 40, # 1 p. 109 - 116 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |