2-(2-chloro-2H-pyridin-1-yl)-1-(4-iodophenyl)ethanone structure
|
Common Name | 2-(2-chloro-2H-pyridin-1-yl)-1-(4-iodophenyl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 7508-66-9 | Molecular Weight | 438.48600 | |
| Density | 1.72g/cm3 | Boiling Point | 468.1ºC at 760 mmHg | |
| Molecular Formula | C13H10BrClINO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 236.9ºC | |
| Name | 2-(2-chloropyridin-1-ium-1-yl)-1-(4-iodophenyl)ethanone,bromide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.72g/cm3 |
|---|---|
| Boiling Point | 468.1ºC at 760 mmHg |
| Molecular Formula | C13H10BrClINO |
| Molecular Weight | 438.48600 |
| Flash Point | 236.9ºC |
| Exact Mass | 436.86800 |
| PSA | 20.95000 |
| LogP | 0.11900 |
| Index of Refraction | 1.679 |
| InChIKey | PAEWLFFQGSXSOY-UHFFFAOYSA-M |
| SMILES | O=C(C[n+]1ccccc1Cl)c1ccc(I)cc1.[Br-] |
|
~%
2-(2-chloro-2H-... CAS#:7508-66-9 |
| Literature: Bahner et al. Journal of the American Chemical Society, 1951 , vol. 73, p. 3499 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-Chlor-1-(4-jod-phenacyl)-pyridinium,Bromid |
| 2-chloro-1-(4-iodo-phenacyl)-pyridinium,bromide |