2,2-diphenyl-1,3-benzodioxol-5-ol structure
|
Common Name | 2,2-diphenyl-1,3-benzodioxol-5-ol | ||
|---|---|---|---|---|
| CAS Number | 75080-59-0 | Molecular Weight | 290.31300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,2-diphenyl-1,3-benzodioxol-5-ol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H14O3 |
|---|---|
| Molecular Weight | 290.31300 |
| Exact Mass | 290.09400 |
| PSA | 38.69000 |
| LogP | 4.06470 |
| InChIKey | XNSZSKVSOUFIQB-UHFFFAOYSA-N |
| SMILES | Oc1ccc2c(c1)OC(c1ccccc1)(c1ccccc1)O2 |
|
~%
2,2-diphenyl-1,... CAS#:75080-59-0 |
| Literature: Unisearch Limited Patent: US4499115 A1, 1985 ; |
|
~%
2,2-diphenyl-1,... CAS#:75080-59-0 |
| Literature: Cole, Edward R.; Crank, George; Minh, H. T. Hai Australian Journal of Chemistry, 1980 , vol. 33, # 3 p. 527 - 543 |
|
~%
2,2-diphenyl-1,... CAS#:75080-59-0 |
| Literature: Cole, Edward R.; Crank, George; Minh, H. T. Hai Australian Journal of Chemistry, 1980 , vol. 33, # 3 p. 527 - 543 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 5-hydroxy-2,2-diphenyl-1,3-benzodioxole |
| 1,3-Benzodioxol-5-ol,2,2-diphenyl |
| 2,2-Diphenyl-5-hydroxy-1,3-benzodioxole |