2,4,4,6,8,8-hexachloro-N,N-bis(3-methylphenyl)-1,3,5,7-tetraza-2$l^{5},4$l^C14H16Cl6N6P4,6$l^C14H16Cl6N6</s structure
|
Common Name | 2,4,4,6,8,8-hexachloro-N,N-bis(3-methylphenyl)-1,3,5,7-tetraza-2$l^{5},4$l^C14H16Cl6N6P4,6$l^C14H16Cl6N6</s | ||
|---|---|---|---|---|
| CAS Number | 7509-02-6 | Molecular Weight | 604.93000 | |
| Density | 1.79g/cm3 | Boiling Point | 627.3ºC at 760 mmHg | |
| Molecular Formula | C14H16Cl6N6P4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 333.2ºC | |
| Name | 2,4,4,6,8,8-hexachloro-2-N,6-N-bis(3-methylphenyl)-1,3,5,7-tetraza-2λ5,4λ5,6λ5,8λ5-tetraphosphacycloocta-1,3,5,7-tetraene-2,6-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.79g/cm3 |
|---|---|
| Boiling Point | 627.3ºC at 760 mmHg |
| Molecular Formula | C14H16Cl6N6P4 |
| Molecular Weight | 604.93000 |
| Flash Point | 333.2ºC |
| Exact Mass | 601.85200 |
| PSA | 112.74000 |
| LogP | 9.94700 |
| Index of Refraction | 1.716 |
| InChIKey | OHKZXSYMLBPORA-WXUXXXNLSA-N |
| SMILES | Cc1cccc(NP2(Cl)=NP(Cl)(Cl)=NP(Cl)(Nc3cccc(C)c3)=NP(Cl)(Cl)=N2)c1 |
|
~%
2,4,4,6,8,8-hex... CAS#:7509-02-6 |
| Literature: John,K. et al. Journal of the American Chemical Society, 1960 , vol. 82, p. 5616 - 5618 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Bis-m-toluidino-hexachlor-tetraphosphonitril |
| 2,4,4,6,8,8-hexachloro-2-N,6-N-bis(3-methylphenyl)-1,3,5,7-tetraza-2 |