2-Buten-1-one,1,3-bis(3-nitrophenyl)- structure
|
Common Name | 2-Buten-1-one,1,3-bis(3-nitrophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 7509-22-0 | Molecular Weight | 312.27700 | |
| Density | 1.338g/cm3 | Boiling Point | 489.4ºC at 760 mmHg | |
| Molecular Formula | C16H12N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 234.2ºC | |
| Name | 1,3-bis(3-nitrophenyl)but-2-en-1-one |
|---|
| Density | 1.338g/cm3 |
|---|---|
| Boiling Point | 489.4ºC at 760 mmHg |
| Molecular Formula | C16H12N2O5 |
| Molecular Weight | 312.27700 |
| Flash Point | 234.2ºC |
| Exact Mass | 312.07500 |
| PSA | 108.71000 |
| LogP | 4.83560 |
| Index of Refraction | 1.634 |
| InChIKey | HYANPVXCNXDNLW-UHFFFAOYSA-N |
| SMILES | CC(=CC(=O)c1cccc([N+](=O)[O-])c1)c1cccc([N+](=O)[O-])c1 |
|
~77%
2-Buten-1-one,1... CAS#:7509-22-0 |
| Literature: Elmorsy, Saad S.; Khalil, Abdel Galel M.; Girges, M. M.; Salama, Tarek A. Journal of Chemical Research, Miniprint, 1997 , # 7 p. 1537 - 1544 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |