(2,3-dimethylphenyl)methyl-(2-hydroxyethyl)-dimethyl-azanium structure
|
Common Name | (2,3-dimethylphenyl)methyl-(2-hydroxyethyl)-dimethyl-azanium | ||
|---|---|---|---|---|
| CAS Number | 7509-54-8 | Molecular Weight | 288.22400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H22BrNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2,3-dimethylphenyl)methyl-(2-hydroxyethyl)-dimethylazanium,bromide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H22BrNO |
|---|---|
| Molecular Weight | 288.22400 |
| Exact Mass | 287.08800 |
| PSA | 20.23000 |
| InChIKey | KUGQOMALCKJMDN-UHFFFAOYSA-M |
| SMILES | Cc1cccc(C[N+](C)(C)CCO)c1C.[Br-] |
|
~%
(2,3-dimethylph... CAS#:7509-54-8 |
| Literature: Jones,G.C.; Hauser,C.R. Journal of Organic Chemistry, 1962 , vol. 27, p. 806 - 814 |
|
~%
(2,3-dimethylph... CAS#:7509-54-8 |
| Literature: Jones,G.C.; Hauser,C.R. Journal of Organic Chemistry, 1962 , vol. 27, p. 806 - 814 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| <2,3-Dimethyl-benzyl>-<2-hydroxy-aethyl>-dimethyl-ammoniumbromid |