1,1,4,4-tetramethyl-2,3,5,6-tetraphenyl-1,4-disiline structure
|
Common Name | 1,1,4,4-tetramethyl-2,3,5,6-tetraphenyl-1,4-disiline | ||
|---|---|---|---|---|
| CAS Number | 751-37-1 | Molecular Weight | 472.76700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C32H32Si2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,1,4,4-tetramethyl-2,3,5,6-tetraphenyl-1,4-disiline |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C32H32Si2 |
|---|---|
| Molecular Weight | 472.76700 |
| Exact Mass | 472.20400 |
| LogP | 8.79560 |
| InChIKey | CDJWHQGFIZDSBC-UHFFFAOYSA-N |
| SMILES | C[Si]1(C)C(c2ccccc2)=C(c2ccccc2)[Si](C)(C)C(c2ccccc2)=C1c1ccccc1 |
|
~84%
1,1,4,4-tetrame... CAS#:751-37-1 |
| Literature: Appler, Hubertus; Neumann, Wilhelm P. Journal of Organometallic Chemistry, 1986 , vol. 314, p. 261 - 272 |
|
~%
1,1,4,4-tetrame... CAS#:751-37-1 |
| Literature: Barton, Thomas J.; Goure, William F.; Witiak, Joanne L.; Wulff, William D. Journal of Organometallic Chemistry, 1982 , vol. 225, # 1 p. 87 - 106 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1.1.4.4-Tetramethyl-2.3.5.6-tetraphenyl-1.4-disila-cyclohexadien |
| 1,1,4,4-Tetramethyl-2,3,5,6-tetraphenyl-1,4-disila-cyclohexadien-2,5 |
| 1,1,4,4-Tetramethyl-tetraphenyl-1,4-disila-cyclohexa-2,5-dien |
| 1,4-Disilacyclohexa-2,5-diene,1,1,4,4-tetramethyl-2,3,5,6-tetraphenyl |